TEL
+ 86-21-6420 0566

Краткое описание:
Номер CAS 68037-96-7 28061-69-0Содержание 95%Упаковка 160 кг/бочка 800 кг/IBC68037-96-7 – Имена и идентификат...
Номер CAS 68037-96-7 28061-69-0
Содержание 95%
Упаковка 160 кг/бочка 800 кг/IBC
| Имя | Amines, (C16-18 and C18-unsatd. alkyl)dimethyl |
| Синонимы | Einecs 268-220-1 Amines, (C16-18 and C18-unsatd. alkyl)dimethyl (C16-C18) And C18 unsaturated alkyldimethylamine (C16-C18) And (C18)unsaturated alkyldimethylamine |
| CAS | 68037-96-7 |
| EINECS | 268-220-1 |
| Молекулярная формула | C18H39N |
| Молярная масса | 269.50896 |
Amines, (C16-18 and C18-unsatd. alkyl)dimethyl is a chemical compound, also known as a soluble acid dye salt. It belongs to amine compounds and has the following properties:
1. Physical properties: Amines, (C16-18 and C18-unsatd. alkyl)dimethyl is a colorless or light yellow liquid with melting point and boiling point range. It can be dissolved in solvents such as alcohol and water.
2. Chemical properties: It has a strong affinity for brightness and can be modified by various chemical reactions. It can be esterified, amidated, acylated and etherified with other compounds.
Amines, (C16-18 and C18-unsatd. alkyl)dimethyl’s main uses are as follows:
1. Surfactant: It is widely used in detergents, lubricants, emulsifiers, antistatic agents and detergents.
2. Dyes: It can be used as acid dye salts for coloring textiles, leather and paper.
3. Preservative: It can be used as a preservative to prevent microbial growth and corrosion.
Amines, (C16-18 and C18-unsatd) dimethyl can be prepared by the following steps:
1. Reaction raw materials: sixteen carbon to eighteen carbon and eighteen carbon unsaturated alkyl dimethyl amine
2. The starting materials are reacted under suitable reaction conditions, usually in a suitable solvent, such as an alcohol.
3. After the reaction, separation and purification are carried out, usually by distillation or extraction.
Информация по технике безопасности:
1. Amines, (C16-18 and C18-unsatd. alkyl)dimethyl is a viscous liquid. Attention should be paid to protective measures such as wearing protective gloves and goggles during operation.
2. Avoid direct contact with skin and eyes, avoid inhalation of vapor.
3. In the use of the process should be maintained in good ventilation conditions, to avoid the use of windless places.
4. Follow the relevant regulations and safe operating procedures for the use and handling of the chemical.
| Имя | N,N-dimethyloctadecenylamine |
| Синонимы | FENTAMINE DMA-O Dimethyloleylamine Oleyl dimethyl amine N,N-dimethyloctadecenylamine N,N-Dimethyloctadecen-1-amine N,N-Dimethyloctadecen-1-amine N,N-dimethyl-1-octadecen-1-amine Octadecen-1-amine, N,N-dimethyl- N,N-dimethyloctadec-17-en-1-amine |
| CAS | 28061-69-0 |
| EINECS | 248-811-0 |
| InChI | InChI=1/C20H41N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3/h4H,1,5-20H2,2-3H3 |
| Молекулярная формула | C20H41N |
| Молярная масса | 295.55 |
| Плотность | 0.818g / cm3 |
| Болинг Точка | 364 ° C при 760 мм рт.ст. |
| Точка возгорания | 156.8 ° C |
| Давление пара | 1.74E-05 мм рт. Ст. При 25 ° C |
| Показатель преломления | 1.456 |
| Используйте | Production of softeners and other surfactants |
| использование | production of surfactants such as softeners |


