TEL
+ 86-21-6420 0566
Xanthopterin Introduction
| Атрибут | Подробнее |
|---|---|
| Имя | Xanthopterin (Synonyms: 黄蝶呤) |
| Химическая формула | SMILES: O=C1NC2=C(N=C1)NC(N)=NC2=O |
| Тип соединения | Unconjugated pteridine compound |
| Главный компонент | Yellow granule in Oriental hornet bear wings |
| Характеристика | Produces a characteristic excitation/emission maximum at 386/456 nm |
| Биологические эффекты | Causes renal growth and hypertrophy in rats; inhibits RNA synthesis |
| Номер в каталоге | HY-119674 (Xanthopterin); HY-119674A (Xanthopterin hydrate) |
Xanthopterin is an unconjugated pteridine compound that serves as the main component of the yellow granule in the wings of the Oriental hornet. This compound is characterized by its ability to produce a distinct excitation/emission maximum at 386/456 nm.
In biological studies, Xanthopterin has been found to exhibit specific effects on rats. When injected into these animals, it causes renal growth and hypertrophy. Additionally, Xanthopterin has been shown to inhibit RNA synthesis, suggesting its potential role in regulating cellular processes.
The hydrate form of Xanthopterin, known as Xanthopterin hydrate, typically exhibits better water solubility and stability compared to its free form. Both forms share the same biological activity at equivalent molar concentrations.
Xanthopterin’s unique chemical structure and biological properties make it a valuable tool for research in various fields, including cell cycle regulation, DNA damage, and RNA synthesis. Its role in inhibiting RNA synthesis and affecting cell growth and differentiation further highlights its potential as a therapeutic agent or research reagent.
Фабрика и отгрузка
